CAS 1286274-22-3

Propanamide, N-ethyl-N-4-piperidinyl-, hydrochloride (1:1)

Description:

Propanamide, N-ethyl-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of the N-ethyl and 4-piperidinyl substituents indicates that it has both aliphatic and cyclic components, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential psychoactive agent or having effects on the central nervous system, given the piperidine ring's common association with various pharmacological activities. Its molecular structure suggests it could interact with neurotransmitter systems, although specific biological effects would depend on further empirical studies. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and pharmacology.

Formula: C₁₀H₂₀N₂O·ClH

InChI: InChI=1S/C10H20N2O.ClH/c1-3-10(13)12(4-2)9-5-7-11-8-6-9;/h9,11H,3-8H2,1-2H3;1H

InChI key: InChIKey=VBBVEFPYNVCJHL-UHFFFAOYSA-N

SMILES: N(C(CC)=O)(CC)C1CCNCC1.Cl

Synonyms:

• Propanamide, N-ethyl-N-4-piperidinyl-, hydrochloride (1:1)

N-Ethyl-N-(piperidin-4-yl)propionamide hydrochloride

Controlled Product

CAS: 1286274-22-3

Please enquire for more information about N-Ethyl-N-(piperidin-4-yl)propionamide hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₂₁ClN₂O

Purity: Min. 95%

Molecular weight: 220.74 g/mol

Ref: 3D-LBC27422