
CAS 1286274-29-0
:Benzamide, N-(trans-4-aminocyclohexyl)-4-chloro-, hydrochloride (1:1)
Description:
Benzamide, N-(trans-4-aminocyclohexyl)-4-chloro-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features a benzene ring attached to a carbonyl group (C=O) and an amine group. The presence of the trans-4-aminocyclohexyl moiety indicates that the compound has a cyclohexane ring with an amino group positioned in a trans configuration relative to the benzamide group. The 4-chloro substitution on the benzene ring introduces a chlorine atom, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its potential applications in pharmaceutical formulations. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is used. Overall, this compound represents a unique combination of structural features that may contribute to its functional characteristics in chemical and biological contexts.
Formula:C13H17ClN2O·ClH
InChI:InChI=1/C13H17ClN2O.ClH/c14-10-3-1-9(2-4-10)13(17)16-12-7-5-11(15)6-8-12;/h1-4,11-12H,5-8,15H2,(H,16,17);1H/t11-,12-;
InChI key:InChIKey=RUIBXSWOYKGYKH-GJTSMBTKNA-N
SMILES:C(N[C@H]1CC[C@H](N)CC1)(=O)C2=CC=C(Cl)C=C2.Cl
Synonyms:- Benzamide, N-(trans-4-aminocyclohexyl)-4-chloro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[(1R*,4R*)-4-Aminocyclohexyl]-4-chlorobenzamide hydrochloride
CAS:Formula:C13H18Cl2N2OMolecular weight:289.2
