
CAS 1286274-31-4
:1,4-Cyclohexanediamine, N1-[(2-bromophenyl)methyl]-, hydrochloride (1:2), trans-
Description:
1,4-Cyclohexanediamine, N1-[(2-bromophenyl)methyl]-, hydrochloride (1:2), trans- is a chemical compound characterized by its specific structural features and functional groups. It contains a cyclohexane ring with two amine groups at the 1 and 4 positions, which contribute to its basicity and potential for hydrogen bonding. The presence of a bromophenyl group introduces aromatic characteristics and enhances its reactivity, particularly in electrophilic substitution reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals and organic synthesis. The trans configuration indicates that the substituents on the cyclohexane ring are positioned opposite each other, influencing the compound's spatial arrangement and steric properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, its unique structure and properties make it a valuable compound for research and development in various chemical fields.
Formula:C13H19BrN2·2ClH
InChI:InChI=1/C13H19BrN2.2ClH/c14-13-4-2-1-3-10(13)9-16-12-7-5-11(15)6-8-12;;/h1-4,11-12,16H,5-9,15H2;2*1H/t11-,12-;;
InChI key:InChIKey=JPHYOXUCAPOPEV-KBTGPXOVNA-N
SMILES:C(N[C@H]1CC[C@H](N)CC1)C2=C(Br)C=CC=C2.Cl
Synonyms:- 1,4-Cyclohexanediamine, N1-[(2-bromophenyl)methyl]-, hydrochloride (1:2), trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R*,4R*)-N1-(2-Bromobenzyl)cyclohexane-1,4-diamine dihydrochloride
CAS:Formula:C13H21BrCl2N2Molecular weight:356.13
