CAS 1286274-39-2

1,1-Dimethylethyl 4-[(2-amino-3-fluorophenoxy)methyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[(2-amino-3-fluorophenoxy)methyl]-1-piperidinecarboxylate, identified by its CAS number 1286274-39-2, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group attached to a tert-butyl group, contributing to its steric bulk and potentially influencing its biological activity. The molecule also contains an amino group and a fluorinated phenoxy moiety, which may enhance its solubility and reactivity. The presence of these functional groups suggests that it could exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in various biological pathways. Its structural complexity indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data for a comprehensive understanding of its behavior in different environments.

Formula: C₁₇H₂₅FN₂O₃

InChI: InChI=1S/C17H25FN2O3/c1-17(2,3)23-16(21)20-9-7-12(8-10-20)11-22-14-6-4-5-13(18)15(14)19/h4-6,12H,7-11,19H2,1-3H3

InChI key: InChIKey=DHUBOUKVYBWXTC-UHFFFAOYSA-N

SMILES: O(CC1CCN(C(OC(C)(C)C)=O)CC1)C2=C(N)C(F)=CC=C2

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[(2-amino-3-fluorophenoxy)methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[(2-amino-3-fluorophenoxy)methyl]-1-piperidinecarboxylate

tert-Butyl 4-[(2-amino-3-fluorophenoxy)methyl]piperidine-1-carboxylate

CAS: 1286274-39-2

Formula: C₁₇H₂₅FN₂O₃

Purity: 95.0%

Molecular weight: 324.396

Ref: 10-F063829