CAS 1286274-42-7

1,1-Dimethylethyl 4-[[(5-nitro-2-pyridinyl)oxy]methyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[(5-nitro-2-pyridinyl)oxy]methyl]-1-piperidinecarboxylate, identified by its CAS number 1286274-42-7, is a chemical compound that features a piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound is characterized by the presence of a nitro group attached to a pyridine ring, contributing to its potential biological activity. The dimethyl group at the 1-position of the piperidine enhances its steric properties, while the carboxylate moiety indicates that it may exhibit acidic behavior. The ether linkage formed by the oxy group suggests potential for reactivity, particularly in nucleophilic substitution reactions. This compound may be of interest in medicinal chemistry due to its structural features that could influence pharmacological properties. Its solubility, stability, and reactivity would depend on the specific functional groups and their interactions in various environments, making it a candidate for further investigation in drug development or chemical synthesis.

Formula: C₁₆H₂₃N₃O₅

InChI: InChI=1S/C16H23N3O5/c1-16(2,3)24-15(20)18-8-6-12(7-9-18)11-23-14-5-4-13(10-17-14)19(21)22/h4-5,10,12H,6-9,11H2,1-3H3

InChI key: InChIKey=YWTIUEKNIAENST-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(N(=O)=O)C=N1)C2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 4-[[(5-nitro-2-pyridinyl)oxy]methyl]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[[(5-nitro-2-pyridinyl)oxy]methyl]-, 1,1-dimethylethyl ester

tert-Butyl 4-[(5-nitropyridin-2-yloxy)methyl]piperidine-1-carboxylate

CAS: 1286274-42-7

Formula: C₁₆H₂₃N₃O₅

Purity: 95.0%

Molecular weight: 337.376

Ref: 10-F063821