CAS 1286274-49-4
:1,1-Dimethylethyl N-[trans-4-[[(2-nitrophenyl)methyl]amino]cyclohexyl]carbamate
Description:
1,1-Dimethylethyl N-[trans-4-[[(2-nitrophenyl)methyl]amino]cyclohexyl]carbamate, identified by its CAS number 1286274-49-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a nitrophenyl moiety, and a cyclohexyl group, which contribute to its unique properties. The compound is likely to exhibit moderate to high lipophilicity due to its bulky groups, influencing its solubility in organic solvents. Additionally, the presence of the nitro group may impart specific reactivity and biological activity, potentially making it of interest in pharmaceutical applications. The carbamate functional group suggests that it may undergo hydrolysis under certain conditions, which is a common reaction for carbamates. Overall, the characteristics of this compound, including its molecular weight, stability, and reactivity, would be essential for understanding its potential applications and behavior in various chemical environments.
Formula:C18H27N3O4
InChI:InChI=1/C18H27N3O4/c1-18(2,3)25-17(22)20-15-10-8-14(9-11-15)19-12-13-6-4-5-7-16(13)21(23)24/h4-7,14-15,19H,8-12H2,1-3H3,(H,20,22)/t14-,15-
InChI key:InChIKey=CXNACXCZPIMRBG-SHTZXODSNA-N
SMILES:C(N[C@H]1CC[C@H](NC(OC(C)(C)C)=O)CC1)C2=C(N(=O)=O)C=CC=C2
Synonyms:- Carbamic acid, N-[trans-4-[[(2-nitrophenyl)methyl]amino]cyclohexyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[trans-4-[[(2-nitrophenyl)methyl]amino]cyclohexyl]carbamate
- tert-Butyl (1R*,4R*)-4-(2-nitrobenzylamino)cyclohexylcarbamate
- TERT-BUTYL (TRANS-4-((2-NITROBENZYL)AMINO)CYCLOHEXYL)CARBAMATE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl (1R*,4R*)-4-(2-nitrobenzylamino)cyclohexylcarbamate
CAS:Formula:C18H27N3O4Molecular weight:349.431
