CAS 1286274-57-4

1,1-Dimethylethyl N-[(1-benzoyl-4-piperidinyl)methyl]carbamate

Description:

1,1-Dimethylethyl N-[(1-benzoyl-4-piperidinyl)methyl]carbamate, identified by its CAS number 1286274-57-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure that includes a dimethyl group, a benzoyl moiety, and a piperidine ring, contributing to its potential biological activity. Typically, carbamates are known for their applications in pharmaceuticals and agrochemicals, often exhibiting properties such as insecticidal or herbicidal activity. The presence of the piperidine ring suggests potential interactions with biological targets, possibly influencing neurotransmitter systems. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications in medicinal chemistry or other fields.

Formula: C₁₈H₂₆N₂O₃

InChI: InChI=1S/C18H26N2O3/c1-18(2,3)23-17(22)19-13-14-9-11-20(12-10-14)16(21)15-7-5-4-6-8-15/h4-8,14H,9-13H2,1-3H3,(H,19,22)

InChI key: InChIKey=XRLOPZVLFXCPCN-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(CNC(OC(C)(C)C)=O)CC1)C2=CC=CC=C2

Synonyms:

• 1,1-Dimethylethyl N-[(1-benzoyl-4-piperidinyl)methyl]carbamate
• Carbamic acid, N-[(1-benzoyl-4-piperidinyl)methyl]-, 1,1-dimethylethyl ester

tert-Butyl [(1-benzoylpiperidin-4-yl)methyl]carbamate

CAS: 1286274-57-4

Formula: C₁₈H₂₆N₂O₃

Purity: 95.0%

Molecular weight: 318.417

Ref: 10-F064358