CAS 1286274-72-3

1,4-Cyclohexanediamine, N1-[(2-methoxyphenyl)methyl]-, hydrochloride (1:2), trans-

Description:

1,4-Cyclohexanediamine, N1-[(2-methoxyphenyl)methyl]-, hydrochloride (1:2), trans- is a chemical compound characterized by its structural features, which include a cyclohexane ring with two amine groups at the 1 and 4 positions, and a methoxyphenylmethyl substituent. This compound exists as a hydrochloride salt, indicating that it is protonated and exists in a stable ionic form when dissolved in water. The trans configuration suggests that the substituents on the cyclohexane ring are oriented in a specific geometric arrangement, which can influence its physical and chemical properties, such as solubility and reactivity. The presence of the methoxy group enhances its lipophilicity, potentially affecting its biological activity. This compound may be of interest in pharmaceutical applications due to its amine functionalities, which can participate in various chemical reactions, including those involving nucleophilic substitution or coordination with metal ions. As with many amines, it may exhibit basic properties and can form salts with acids, contributing to its utility in various chemical contexts.

Formula: C₁₄H₂₂N₂O·2ClH

InChI: InChI=1/C14H22N2O.2ClH/c1-17-14-5-3-2-4-11(14)10-16-13-8-6-12(15)7-9-13;;/h2-5,12-13,16H,6-10,15H2,1H3;2*1H/t12-,13-;;

InChI key: InChIKey=BSFFLUGKLIIRRU-MQQSYLBWNA-N

SMILES: C(N[C@H]1CC[C@H](N)CC1)C2=C(OC)C=CC=C2.Cl

Synonyms:

• 1,4-Cyclohexanediamine, N1-[(2-methoxyphenyl)methyl]-, hydrochloride (1:2), trans-

(1R*,4R*)-N1-(2-Methoxybenzyl)cyclohexane-1,4-diamine dihydrochloride

CAS: 1286274-72-3

Formula: C₁₄H₂₄Cl₂N₂O

Molecular weight: 307.26

Ref: 10-F097562