CymitQuimica logo

CAS 1286274-81-4

:

Methanone, (4-amino-1-piperidinyl)(3-bromophenyl)-, hydrochloride (1:1)

Description:
Methanone, (4-amino-1-piperidinyl)(3-bromophenyl)-, hydrochloride (1:1), identified by CAS number 1286274-81-4, is a chemical compound that features a piperidine ring substituted with an amino group and a phenyl group that is further brominated. This compound is typically characterized by its hydrochloride salt form, which enhances its solubility in water and may influence its pharmacological properties. The presence of the bromine atom introduces additional reactivity and can affect the compound's biological activity. Methanone derivatives often exhibit significant interest in medicinal chemistry due to their potential applications in drug development, particularly in targeting various biological pathways. The structural characteristics, including the piperidine and bromophenyl moieties, suggest potential interactions with biological receptors or enzymes. As with many organic compounds, the specific properties such as melting point, boiling point, and solubility can vary based on the conditions and purity of the sample. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential biological activity.
Formula:C12H15BrN2O·ClH
InChI:InChI=1S/C12H15BrN2O.ClH/c13-10-3-1-2-9(8-10)12(16)15-6-4-11(14)5-7-15;/h1-3,8,11H,4-7,14H2;1H
InChI key:InChIKey=PLNYNROWTOWACB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Br)=CC=C1)N2CCC(N)CC2.Cl
Synonyms:
  • Methanone, (4-amino-1-piperidinyl)(3-bromophenyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.