CAS 1286275-00-0

1,1-Dimethylethyl N-[trans-4-[[(2-fluorophenyl)methyl]amino]cyclohexyl]carbamate

Description:

1,1-Dimethylethyl N-[trans-4-[[(2-fluorophenyl)methyl]amino]cyclohexyl]carbamate, identified by its CAS number 1286275-00-0, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a cyclohexyl ring, and a fluorophenyl moiety, which contribute to its unique chemical properties. The presence of the carbamate functional group indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit specific biological activities due to its structural components, which can influence its interaction with biological targets. Additionally, the fluorine atom in the phenyl ring can enhance lipophilicity and metabolic stability, making it a subject of interest in drug design. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.

Formula: C₁₈H₂₇FN₂O₂

InChI: InChI=1/C18H27FN2O2/c1-18(2,3)23-17(22)21-15-10-8-14(9-11-15)20-12-13-6-4-5-7-16(13)19/h4-7,14-15,20H,8-12H2,1-3H3,(H,21,22)/t14-,15-

InChI key: InChIKey=VJOIHOVMAVSBHN-SHTZXODSNA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1CC[C@H](NCC2=C(F)C=CC=C2)CC1

Synonyms:

• 1,1-Dimethylethyl N-[trans-4-[[(2-fluorophenyl)methyl]amino]cyclohexyl]carbamate
• Carbamic acid, N-[trans-4-[[(2-fluorophenyl)methyl]amino]cyclohexyl]-, 1,1-dimethylethyl ester

tert-Butyl (1R*,4R*)-4-(2-fluorobenzylamino)cyclohexylcarbamate

CAS: 1286275-00-0

Formula: C₁₈H₂₇FN₂O₂

Molecular weight: 322.424

Ref: 10-F097444