CAS 1286275-01-1

1,1-Dimethylethyl N-[[1-(1-ethylpropyl)-4-piperidinyl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[1-(1-ethylpropyl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1286275-01-1, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics such as being a colorless to pale yellow liquid or solid, depending on its formulation and purity. It is known for its potential use in agricultural applications, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. The compound features a piperidine ring, which contributes to its biological activity, and the presence of the dimethyl group enhances its lipophilicity, potentially affecting its absorption and distribution in living organisms. Additionally, it may exhibit moderate to high stability under various environmental conditions, although specific stability data would depend on the formulation and storage conditions. As with many chemical substances, safety data sheets should be consulted for handling, toxicity, and environmental impact information.

Formula: C₁₆H₃₂N₂O₂

InChI: InChI=1S/C16H32N2O2/c1-6-14(7-2)18-10-8-13(9-11-18)12-17-15(19)20-16(3,4)5/h13-14H,6-12H2,1-5H3,(H,17,19)

InChI key: InChIKey=RVIVEGRDLGQNDF-UHFFFAOYSA-N

SMILES: C(CC)(CC)N1CCC(CNC(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl N-[[1-(1-ethylpropyl)-4-piperidinyl]methyl]carbamate
• Carbamic acid, N-[[1-(1-ethylpropyl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
• tert-Butyl [1-(pentan-3-yl)piperidin-4-yl]methylcarbamate

tert-Butyl k[1-(pentan-3-yl)piperidin-4-yl]methyllcarbamate

CAS: 1286275-01-1

Formula: C₁₆H₃₂N₂O₂

Purity: 95.0%

Molecular weight: 284.444

Ref: 10-F064344