CAS 1286275-17-9

4-Piperidinamine, 1-[(3-chloro-2-fluorophenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[(3-chloro-2-fluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a chloro and a fluorine substituent on a phenyl ring, contributing to its unique reactivity and potential biological activity. The hydrochloride form indicates that it is a salt, which often enhances solubility in water and stability. The presence of the piperidinamine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are known for their diverse biological activities. The specific arrangement of substituents can influence the compound's pharmacokinetics and pharmacodynamics, making it a subject of interest in drug discovery. As with many chemical substances, safety data and handling precautions should be observed, especially considering the presence of halogen atoms, which can affect toxicity and environmental impact.

Formula: C₁₂H₁₆ClFN₂·2ClH

InChI: InChI=1S/C12H16ClFN2.2ClH/c13-11-3-1-2-9(12(11)14)8-16-6-4-10(15)5-7-16;;/h1-3,10H,4-8,15H2;2*1H

InChI key: InChIKey=WYTVTROZTPGFKK-UHFFFAOYSA-N

SMILES: C(C1=C(F)C(Cl)=CC=C1)N2CCC(N)CC2.Cl

Synonyms:

• 4-Piperidinamine, 1-[(3-chloro-2-fluorophenyl)methyl]-, hydrochloride (1:2)

1-(3-Chloro-2-fluorobenzyl)piperidin-4-amine dihydrochloride

CAS: 1286275-17-9

Formula: C₁₂H₁₈Cl₃FN₂

Purity: 95.0%

Molecular weight: 315.64

Ref: 10-F064062