CAS 1286275-26-0
:1,1-Dimethylethyl N-[trans-4-[(2-bromobenzoyl)amino]cyclohexyl]carbamate
Description:
1,1-Dimethylethyl N-[trans-4-[(2-bromobenzoyl)amino]cyclohexyl]carbamate, identified by its CAS number 1286275-26-0, is a synthetic organic compound characterized by its complex molecular structure. It features a carbamate functional group, which is indicative of its potential use in various chemical applications, including as a pharmaceutical intermediate or in agrochemical formulations. The presence of a bromobenzoyl moiety suggests that it may exhibit biological activity, possibly as an inhibitor or modulator in biochemical pathways. The trans-4-cyclohexyl configuration indicates a specific stereochemistry that could influence its interaction with biological targets. Additionally, the dimethyl substituents on the nitrogen atom enhance its lipophilicity, potentially affecting its solubility and permeability in biological systems. Overall, this compound's unique structural features may contribute to its reactivity and efficacy in specific applications, warranting further investigation into its properties and potential uses in medicinal chemistry or related fields.
Formula:C18H25BrN2O3
InChI:InChI=1/C18H25BrN2O3/c1-18(2,3)24-17(23)21-13-10-8-12(9-11-13)20-16(22)14-6-4-5-7-15(14)19/h4-7,12-13H,8-11H2,1-3H3,(H,20,22)(H,21,23)/t12-,13-
InChI key:InChIKey=RWNCOMMJZGEEHM-JOCQHMNTNA-N
SMILES:C(N[C@H]1CC[C@H](NC(OC(C)(C)C)=O)CC1)(=O)C2=C(Br)C=CC=C2
Synonyms:- Carbamic acid, N-[trans-4-[(2-bromobenzoyl)amino]cyclohexyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[trans-4-[(2-bromobenzoyl)amino]cyclohexyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl (1R*,4R*)-4-(2-bromobenzamido)cyclohexylcarbamate
CAS:Formula:C18H25BrN2O3Molecular weight:397.313
