CAS 1286275-43-1

2-[(1-Methyl-4-piperidinyl)methoxy]benzenamine

Description:

2-[(1-Methyl-4-piperidinyl)methoxy]benzenamine, identified by its CAS number 1286275-43-1, is a chemical compound characterized by its structural features, which include a benzene ring substituted with an amine group and a methoxy group linked to a piperidine moiety. This compound typically exhibits properties associated with both aromatic amines and piperidine derivatives, such as potential basicity due to the presence of the amine functional group. The methoxy group can influence its solubility and reactivity, making it more lipophilic. The piperidine ring contributes to its cyclic structure, which may affect its biological activity and interaction with various receptors. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The presence of the methyl group on the piperidine enhances its steric and electronic characteristics, which can further influence the compound's behavior in chemical reactions and biological systems. Overall, this compound's unique structure suggests a range of possible applications in drug development and chemical synthesis.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1S/C13H20N2O/c1-15-8-6-11(7-9-15)10-16-13-5-3-2-4-12(13)14/h2-5,11H,6-10,14H2,1H3

InChI key: InChIKey=XMKAYJYRKAZECY-UHFFFAOYSA-N

SMILES: O(CC1CCN(C)CC1)C2=C(N)C=CC=C2

Synonyms:

• Benzenamine, 2-[(1-methyl-4-piperidinyl)methoxy]-
• 2-[(1-Methyl-4-piperidinyl)methoxy]benzenamine

2-[(1-Methylpiperidin-4-yl)methoxy]aniline

CAS: 1286275-43-1

Formula: C₁₃H₂₀N₂O

Purity: 95.0%

Molecular weight: 220.316

Ref: 10-F063855