CAS 1286275-53-3

Cyclopropanecarboxamide, N-(trans-4-aminocyclohexyl)-, hydrochloride (1:1)

Description:

Cyclopropanecarboxamide, N-(trans-4-aminocyclohexyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an amine functional group. This compound features a cyclopropanecarboxamide moiety, indicating the presence of a carboxamide group attached to a cyclopropane, along with a trans-4-aminocyclohexyl substituent. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound may exhibit biological activity due to the presence of the amine group, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as melting point, solubility, and reactivity, would be influenced by its specific functional groups and overall molecular geometry. As with many amides, it may also exhibit characteristics typical of amide compounds, such as moderate polarity and potential for forming hydrogen bonds.

Formula: C₁₀H₁₈N₂O·ClH

InChI: InChI=1/C10H18N2O.ClH/c11-8-3-5-9(6-4-8)12-10(13)7-1-2-7;/h7-9H,1-6,11H2,(H,12,13);1H/t8-,9-;

InChI key: InChIKey=QAIKFWMHPSKOEY-JUAUBFSONA-N

SMILES: C(N[C@H]1CC[C@H](N)CC1)(=O)C2CC2.Cl

Synonyms:

• Cyclopropanecarboxamide, N-(trans-4-aminocyclohexyl)-, hydrochloride (1:1)

N-[(1R*,4R*)-4-Aminocyclohexyl]cyclopropane-carboxamide hydrochloride

CAS: 1286275-53-3

Molecular weight: 218.73

Ref: 10-F097574