CAS 1286275-67-9

1,1-Dimethylethyl N-[[1-(2,2-dimethyl-1-oxopropyl)-4-piperidinyl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[1-(2,2-dimethyl-1-oxopropyl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1286275-67-9, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics common to carbamate derivatives, such as the presence of a carbamate functional group (-NH-CO-O-), which contributes to its reactivity and potential biological activity. The compound features a piperidine ring, which is known for its role in various pharmacological applications, and a dimethylated structure that may influence its lipophilicity and solubility. Its molecular structure suggests potential uses in medicinal chemistry, possibly as an active ingredient in pharmaceuticals or agrochemicals. The presence of multiple functional groups indicates that it may engage in various chemical interactions, making it a candidate for further research in drug development or as a biochemical tool. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.

Formula: C₁₆H₃₀N₂O₃

InChI: InChI=1S/C16H30N2O3/c1-15(2,3)13(19)18-9-7-12(8-10-18)11-17-14(20)21-16(4,5)6/h12H,7-11H2,1-6H3,(H,17,20)

InChI key: InChIKey=HMBDRFVMTXZYPS-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(=O)N1CCC(CNC(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl N-[[1-(2,2-dimethyl-1-oxopropyl)-4-piperidinyl]methyl]carbamate
• Carbamic acid, N-[[1-(2,2-dimethyl-1-oxopropyl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester

tert-Butyl [(1-pivaloylpiperidin-4-yl)methyl]carbamate

CAS: 1286275-67-9

Formula: C₁₆H₃₀N₂O₃

Purity: 95.0%

Molecular weight: 298.427

Ref: 10-F064356