CAS 1286275-68-0

Methanone, [4-(aminomethyl)-1-piperidinyl](tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:1)

Description:

Methanone, [4-(aminomethyl)-1-piperidinyl](tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a piperidine ring and a tetrahydro-pyran moiety. This substance is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical contexts. The presence of the aminomethyl group suggests potential reactivity and biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for biological targets, influencing neurotransmitter systems, or serving as a precursor in synthetic pathways. Its molecular interactions, stability, and specific reactivity would depend on the functional groups present and the overall three-dimensional conformation. As with many organic compounds, safety and handling precautions are essential, particularly due to the potential for biological activity and the need for proper storage conditions to maintain its integrity.

Formula: C₁₂H₂₂N₂O₂·ClH

InChI: InChI=1S/C12H22N2O2.ClH/c13-9-10-1-5-14(6-2-10)12(15)11-3-7-16-8-4-11;/h10-11H,1-9,13H2;1H

InChI key: InChIKey=XGZSVENVAKKPFK-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(CN)CC1)C2CCOCC2.Cl

Synonyms:

• Methanone, [4-(aminomethyl)-1-piperidinyl](tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:1)

[4-(Aminomethyl)piperidin-1-yl](tetrahydro-2H-pyran-4-yl)methanone hydrochloride

CAS: 1286275-68-0

Formula: C₁₂H₂₃ClN₂O₂

Purity: 95.0%

Molecular weight: 262.78

Ref: 10-F064337