CAS 1286275-71-5

3-[[4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]carbonyl]benzoic acid

Description:

3-[[4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]carbonyl]benzoic acid, identified by its CAS number 1286275-71-5, is a synthetic organic compound characterized by its complex structure, which includes a benzoic acid moiety and a piperidine ring. This compound features a dimethylethoxycarbonyl group, which contributes to its lipophilicity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form salts. Its structural features may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a class of molecules with potential utility in drug design and development.

Formula: C₁₈H₂₄N₂O₅

InChI: InChI=1S/C18H24N2O5/c1-18(2,3)25-17(24)19-14-7-9-20(10-8-14)15(21)12-5-4-6-13(11-12)16(22)23/h4-6,11,14H,7-10H2,1-3H3,(H,19,24)(H,22,23)

InChI key: InChIKey=VOFIVCCHJANLPG-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C(O)=O)=CC=C1)N2CCC(NC(OC(C)(C)C)=O)CC2

Synonyms:

• Benzoic acid, 3-[[4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-piperidinyl]carbonyl]-
• 3-[[4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]carbonyl]benzoic acid

3-[4-(tert-Butoxycarbonylamino)piperidine-1-carbonyl]benzoic acid

CAS: 1286275-71-5

Formula: C₁₈H₂₄N₂O₅

Purity: 95.0%

Molecular weight: 348.399

Ref: 10-F064091