
CAS 1286275-80-6
:1,4-Cyclohexanediamine, N1-(tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:2), trans-
Description:
1,4-Cyclohexanediamine, N1-(tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:2), trans- is a chemical compound characterized by its cyclic structure and the presence of amine functional groups. It features a cyclohexane ring with two amine substituents at the 1 and 4 positions, which contributes to its potential as a building block in organic synthesis and pharmaceuticals. The tetrahydro-2H-pyran moiety introduces a heterocyclic element, enhancing its reactivity and solubility in various solvents. The hydrochloride form indicates that the compound is a salt, which typically improves stability and solubility in aqueous environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its trans configuration suggests specific spatial arrangements of substituents, which can influence its chemical behavior and interactions. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research and application in various chemical fields.
Formula:C11H22N2O·2ClH
InChI:InChI=1/C11H22N2O.2ClH/c12-9-1-3-10(4-2-9)13-11-5-7-14-8-6-11;;/h9-11,13H,1-8,12H2;2*1H/t9-,10-;;
InChI key:InChIKey=XTEZQWMVPHYQKX-HIZJWYRFNA-N
SMILES:N([C@@H]1CC[C@@H](N)CC1)C2CCOCC2.Cl
Synonyms:- 1,4-Cyclohexanediamine, N1-(tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:2), trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R*,4R*)-N1-(Tetrahydro-2H-pyran-4-yl)cyclohexane-1,4-diamine dihydrochloride
CAS:Formula:C11H24Cl2N2OMolecular weight:271.23
