CAS 128631-86-7
:HIV envelope protein gp41 (519-541)
Description:
HIV envelope protein gp41 (519-541) is a peptide derived from the envelope glycoprotein of the Human Immunodeficiency Virus (HIV), specifically from the transmembrane protein gp41, which plays a crucial role in the virus's ability to infect host cells. This peptide corresponds to a specific region of gp41, which is involved in the fusion of the viral membrane with the host cell membrane, facilitating viral entry. The CAS number 128631-86-7 identifies this peptide in chemical databases, indicating its unique chemical identity. Characteristically, gp41 (519-541) is hydrophobic, reflecting its role in membrane interactions, and it often adopts an alpha-helical structure, which is essential for its function in membrane fusion. The study of this peptide is significant for vaccine development and therapeutic interventions, as it is a target for neutralizing antibodies and fusion inhibitors. Understanding its structure and function can provide insights into HIV pathogenesis and potential strategies for combating HIV infection.
Formula:C95H155N27O26S
InChI:InChI=1/C95H155N27O26S/c1-18-51(10)76(120-74(131)44-105-92(146)75(50(8)9)121-79(133)52(11)96)93(147)106-41-71(128)109-56(15)83(137)115-64(36-49(6)7)88(142)118-66(38-59-28-23-20-24-29-59)90(144)117-63(35-48(4)5)86(140)104-43-72(129)111-65(37-58-26-21-19-22-27-58)89(143)116-62(34-47(2)3)85(139)103-40-70(127)107-54(13)81(135)110-53(12)80(134)101-42-73(130)112-68(46-124)91(145)122-77(57(16)125)94(148)114-61(31-33-149-17)84(138)102-39-69(126)108-55(14)82(136)113-60(30-25-32-100-95(98)99)87(141)119-67(45-123)78(97)132/h19-24,26-29,47-57,60-68,75-77,123-125H,18,25,30-46,96H2,1-17H3,(H2,97,132)(H,101,134)(H,102,138)(H,103,139)(H,104,140)(H,105,146)(H,106,147)(H,107,127)(H,108,126)(H,109,128)(H,110,135)(H,111,129)(H,112,130)(H,113,136)(H,114,148)(H,115,137)(H,116,143)(H,117,144)(H,118,142)(H,119,141)(H,120,131)(H,121,133)(H,122,145)(H4,98,99,100)/t51-,52-,53-,54-,55-,56-,57+,60-,61-,62-,63-,64-,65-,66-,67-,68-,75-,76-,77-/m0/s1
Synonyms:- Fp-1, Hiv
- L-Alanyl-L-valylglycyl-L-isoleucylglycyl-L-alanyl-L-leucyl-L-phenylalanyl-L-leucylglycyl-L-phenylalanyl-L-leucylglycyl-L-alanyl-L-alanylglycyl-seryl-L-threonyl-L-methionylglycyl-L-alanyl-L-arginyl-L-serinamide
- L-Serinamide, L-alanyl-L-valylglycyl-L-isoleucylglycycl-L-alanyl-L-leucyl-L-phenylalanyl-L-leucylglycyl-L-phenylalanyl-L-leucylglycyl-L-alanyl-L-alanylglycyl-L-seryl-L-threonyl-L-methionylglycyl-L-alanyl-L-arginyl-
- L-Serinamide, L-alanyl-L-valylglycyl-L-isoleucylglycyl-L-alanyl-L-leucyl-L-phenylalanyl-L-leucylglycyl-L-phenylalanyl-L-leucylglycyl-L-alanyl-L-alanylglycyl-L-seryl-L-threonyl-L-methionylglycyl-L-alanyl-L-arginyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
HIV-1 env Protein gp41 (1-23) amide (isolates BRU/JRCSF)
CAS:<p>Please enquire for more information about HIV-1 env Protein gp41 (1-23) amide (isolates BRU/JRCSF) including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C95H155N27O26SPurity:Min. 95%Molecular weight:2,123.48 g/mol
