CymitQuimica logo

CAS 1286317-54-1

:

N-(3R)-3-Piperidinylcyclopropanecarboxamide

Description:
N-(3R)-3-Piperidinylcyclopropanecarboxamide is a chemical compound characterized by its unique structural features, which include a piperidine ring and a cyclopropane moiety. The piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals. The presence of the cyclopropanecarboxamide group suggests that this compound may exhibit interesting steric and electronic properties, which can influence its interactions with biological targets. The specific stereochemistry indicated by the (3R) designation implies that the compound has a defined spatial arrangement, which is crucial for its activity and binding affinity in biological systems. Additionally, the compound may possess solubility characteristics that are influenced by its functional groups, affecting its pharmacokinetics and bioavailability. Overall, N-(3R)-3-Piperidinylcyclopropanecarboxamide represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of medicinal chemistry and drug development.
Formula:C9H16N2O
InChI:InChI=1S/C9H16N2O/c12-9(7-3-4-7)11-8-2-1-5-10-6-8/h7-8,10H,1-6H2,(H,11,12)/t8-/m1/s1
InChI key:InChIKey=XOXSBDNCEBIBQH-MRVPVSSYSA-N
SMILES:C(N[C@@H]1CCCNC1)(=O)C2CC2
Synonyms:
  • N-(3R)-3-Piperidinylcyclopropanecarboxamide
  • Cyclopropanecarboxamide, N-(3R)-3-piperidinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.