CAS 128640-74-4
:4-CHLORO-6-(4-METHYLPHENYL)-2-(METHYLTHIO)PYRIMIDINE-5-CARBONITRILE
Description:
4-Chloro-6-(4-methylphenyl)-2-(methylthio)pyrimidine-5-carbonitrile, with the CAS number 128640-74-4, is a chemical compound that belongs to the pyrimidine class of heterocyclic compounds. It features a pyrimidine ring substituted with a chlorine atom, a methylthio group, and a 4-methylphenyl group, as well as a carbonitrile functional group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its role in drug development. The presence of the carbonitrile group suggests it may participate in nucleophilic reactions, while the methylthio and chloro substituents can influence its reactivity and solubility. The compound's structure indicates it may exhibit specific interactions with biological targets, making it of interest in pharmacological studies. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitution and condensation reactions. Overall, this compound exemplifies the complexity and diversity of pyrimidine derivatives in chemical research.
Formula:C13H10ClN3S
InChI:InChI=1/C13H10ClN3S/c1-8-3-5-9(6-4-8)11-10(7-15)12(14)17-13(16-11)18-2/h3-6H,1-2H3
SMILES:Cc1ccc(cc1)c1c(C#N)c(Cl)nc(n1)SC
Synonyms:- 4-Chloro-5-cyano-2-methylthio-6-(p-tolyl)pyrimidine
- 4-Chloro-6-(4-Methylphenyl)-2-(Methylsulfanyl)Pyrimidine-5-Carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
