CAS 128651-92-3
:N-(2-AMINO-CYCLOHEXYL)-ACETAMIDE
Description:
N-(2-Amino-cyclohexyl)-acetamide, with the CAS number 128651-92-3, is an organic compound characterized by its amide functional group and a cyclohexyl ring. This substance features an amino group attached to a cyclohexane structure, which contributes to its potential biological activity. The presence of the acetamide moiety suggests that it may exhibit properties typical of amides, such as moderate polarity and the ability to participate in hydrogen bonding. This compound is likely to be a solid at room temperature, with solubility in polar solvents due to its functional groups. Its structural characteristics may allow it to interact with biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, the cyclohexyl group can influence the compound's conformational flexibility and steric properties, which are important for its potential interactions with biological targets. As with many amides, it may also exhibit stability under various conditions, although specific reactivity would depend on the surrounding environment and functional groups present.
Formula:C8H16N2O
InChI:InChI=1/C8H16N2O/c1-6(11)10-8-5-3-2-4-7(8)9/h7-8H,2-5,9H2,1H3,(H,10,11)
SMILES:CC(=NC1CCCCC1N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
