CAS 128656-63-3
:acetyl-phenylalanyl trifluoromethyl ketone
Description:
Acetyl-phenylalanyl trifluoromethyl ketone, identified by its CAS number 128656-63-3, is a synthetic organic compound characterized by its unique structural features, including an acetyl group, a phenylalanine moiety, and a trifluoromethyl ketone functional group. This compound is typically used in biochemical research, particularly in studies involving proteases and other enzymes, due to its ability to act as a selective inhibitor. The presence of the trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, making it an interesting candidate for drug development. Its molecular structure contributes to its reactivity and interaction with biological targets, which can be explored in various pharmacological contexts. Additionally, the compound's stability under standard laboratory conditions allows for its use in various synthetic and analytical applications. Overall, acetyl-phenylalanyl trifluoromethyl ketone serves as a valuable tool in medicinal chemistry and biochemistry, facilitating the exploration of enzyme mechanisms and the development of therapeutic agents.
Formula:C12H12F3NO2
InChI:InChI=1/C12H12F3NO2/c1-8(17)16-10(11(18)12(13,14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,16,17)/t10-/m0/s1
SMILES:CC(=N[C@@H](Cc1ccccc1)C(=O)C(F)(F)F)O
Synonyms:- (S)-N-(3,3,3-Trifluoro-2-oxo-1-(phenylmethyl)propyl)acetamide
- Ac-Phe-CF3
- Acetamide, N-(3,3,3-trifluoro-2-oxo-1-(phenylmethyl)propyl)-, (S)-
- N-[(2S)-4,4,4-trifluoro-3-oxo-1-phenylbutan-2-yl]acetamide
- Acetyl-phenylalanyl trifluoromethyl ketone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetamide, N-[(1S)-3,3,3-trifluoro-2-oxo-1-(phenylmethyl)propyl]-
CAS:Formula:C12H12F3NO2Molecular weight:259.2244
