CAS 1286734-82-4

3-bromo-6-fluoro-2-nitrotoluene

Description:

3-Bromo-6-fluoro-2-nitrotoluene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and a nitro group attached to a toluene ring. This compound features a toluene backbone, which consists of a methyl group attached to a benzene ring, and the substituents are located at specific positions on the ring, influencing its chemical reactivity and properties. The bromine and fluorine atoms are halogens, which can enhance the compound's electrophilic character, while the nitro group is a strong electron-withdrawing group, further affecting its reactivity. This compound is likely to be a pale yellow to brown solid, with potential applications in organic synthesis, pharmaceuticals, or agrochemicals. Its unique combination of functional groups may also impart specific physical properties, such as solubility in organic solvents and varying melting and boiling points. Safety and handling precautions should be observed, as halogenated compounds can pose health and environmental risks.

Formula: C₇H₅BrFNO₂

InChI: InChI=1S/C7H5BrFNO2/c1-4-6(9)3-2-5(8)7(4)10(11)12/h2-3H,1H3

InChI key: InChIKey=PZZUMDDGTJMPQD-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C)C(F)=CC=C1Br

Benzene, 1-bromo-4-fluoro-3-methyl-2-nitro-

CAS: 1286734-82-4

Formula: C₇H₅BrFNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 234.0225

Ref: IN-DA000YAB

3-Bromo-6-fluoro-2-nitrotoluene

CAS: 1286734-82-4

3-Bromo-6-fluoro-2-nitrotoluene

Formula: C₇H₅BrFNO₂

Purity: ≥95%

Color and Shape: clear. light orange to light red liquid

Molecular weight: 234.02g/mol

Ref: 54-PC48413

1-Bromo-4-fluoro-3-methyl-2-nitrobenzene

CAS: 1286734-82-4

Formula: C₇H₅BrFNO₂

Purity: 96%

Color and Shape: Solid, No data available.

Molecular weight: 234.024

Ref: 10-F456406