CymitQuimica logo

CAS 1286743-81-4

:

6-Iodo-2-pyrazinecarbonitrile

Description:
6-Iodo-2-pyrazinecarbonitrile is a heterocyclic organic compound characterized by the presence of both a pyrazine ring and a cyano group. The compound features an iodine atom substituted at the 6-position of the pyrazine ring, which contributes to its unique reactivity and potential applications in various chemical reactions. The cyano group, located at the 2-position, enhances the compound's polarity and can participate in nucleophilic addition reactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Its physical properties, such as solubility and melting point, can vary based on the solvent and conditions used. Additionally, the presence of the iodine atom may impart specific electronic properties, making it useful in medicinal chemistry for targeting biological pathways. Safety data should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C5H2IN3
InChI:InChI=1S/C5H2IN3/c6-5-3-8-2-4(1-7)9-5/h2-3H
InChI key:InChIKey=RVLKIVDWWONONH-UHFFFAOYSA-N
SMILES:C(#N)C1=NC(I)=CN=C1
Synonyms:
  • 6-Iodopyrazine-2-carbonitrile
  • 6-Iodo-2-pyrazinecarbonitrile
  • 2-Pyrazinecarbonitrile, 6-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.