
CAS 1286743-82-5
:6-(Trifluoromethyl)-2-pyrazinecarbonitrile
Description:
6-(Trifluoromethyl)-2-pyrazinecarbonitrile is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The cyano group (-CN) at the 2-position contributes to its reactivity, making it a useful intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique functional groups suggest potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the trifluoromethyl group can impart unique electronic properties, making it a subject of interest in medicinal chemistry for developing compounds with specific biological activities. Safety data should be consulted for handling, as fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C6H2F3N3
InChI:InChI=1S/C6H2F3N3/c7-6(8,9)5-3-11-2-4(1-10)12-5/h2-3H
InChI key:InChIKey=WSNCWKPZMLCLSM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC(C#N)=CN=C1
Synonyms:- 2-Pyrazinecarbonitrile, 6-(trifluoromethyl)-
- 6-(Trifluoromethyl)-2-pyrazinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.