CAS 1286744-16-8

4-(Trifluoromethyl)-2-benzofurancarboxylic acid

Description:

4-(Trifluoromethyl)-2-benzofurancarboxylic acid is an organic compound characterized by the presence of a benzofuran moiety substituted with a trifluoromethyl group and a carboxylic acid functional group. The trifluoromethyl group contributes to the compound's unique electronic properties, enhancing its lipophilicity and potentially influencing its reactivity and biological activity. The benzofuran structure provides a fused ring system that can participate in various chemical reactions, making it a versatile scaffold in organic synthesis. This compound is likely to exhibit acidic behavior due to the carboxylic acid group, which can donate protons in solution. Its fluorinated nature may also impart distinctive characteristics such as increased stability and altered solubility compared to non-fluorinated analogs. Additionally, compounds with such structural features are often investigated for their potential applications in pharmaceuticals, agrochemicals, and materials science, owing to their unique properties and reactivity profiles.

Formula: C₁₀H₅F₃O₃

InChI: InChI=1S/C10H5F3O3/c11-10(12,13)6-2-1-3-7-5(6)4-8(16-7)9(14)15/h1-4H,(H,14,15)

InChI key: InChIKey=CMQIGGLUDXINDT-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(OC(C(O)=O)=C2)=CC=C1

Synonyms:

• 2-Benzofurancarboxylic acid, 4-(trifluoromethyl)-
• 4-(Trifluoromethyl)-2-benzofurancarboxylic acid