CAS 1286753-88-5

5-(1,1-Dimethylethyl) 3-ethyl 6,7-dihydropyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylate

Description:

5-(1,1-Dimethylethyl) 3-ethyl 6,7-dihydropyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylate is a complex organic compound characterized by its unique pyrazolo structure, which incorporates both ethyl and tert-butyl substituents. This compound features a dihydropyrazine core, contributing to its potential biological activity and chemical reactivity. The presence of two carboxylate groups indicates that it can participate in various chemical reactions, such as esterification or amidation, and may exhibit acidic properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can interact with biological targets. Additionally, the compound's stability and solubility can be influenced by the bulky tert-butyl group, which may affect its pharmacokinetic properties. Overall, this compound represents a class of heterocyclic compounds that are of interest for their potential therapeutic applications and chemical versatility.

Formula: C₁₄H₂₁N₃O₄

InChI: InChI=1S/C14H21N3O4/c1-5-20-12(18)10-8-15-17-7-6-16(9-11(10)17)13(19)21-14(2,3)4/h8H,5-7,9H2,1-4H3

InChI key: InChIKey=CXWBUPNZOYLFSY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C2N(CCN(C(OC(C)(C)C)=O)C2)N=C1

Synonyms:

• 5-(1,1-Dimethylethyl) 3-ethyl 6,7-dihydropyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylate
• Pyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylic acid, 6,7-dihydro-, 5-(1,1-dimethylethyl) 3-ethyl ester

5-tert-butyl 3-ethyl 4H,5H,6H,7H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxylate

CAS: 1286753-88-5

5-tert-butyl 3-ethyl 4H,5H,6H,7H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxylate

Purity: ≥95%

Molecular weight: 295.33g/mol

Ref: 54-OR310958

5-(tert-Butyl) 3-ethyl 6,7-dihydropyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylate

CAS: 1286753-88-5

Purity: 97%

Molecular weight: 295.3389893

Ref: 10-F621865