
CAS 1286754-13-9
:3-(Methylsulfonyl)-3,9-diazaspiro[5.5]undecane
Description:
3-(Methylsulfonyl)-3,9-diazaspiro[5.5]undecane is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms and a methylsulfonyl group. This compound belongs to a class of spiro compounds that are known for their interesting biological activities and potential applications in medicinal chemistry. The presence of the methylsulfonyl group contributes to its solubility and reactivity, making it a subject of interest in various chemical syntheses and biological studies. The diazaspiro framework imparts rigidity to the molecule, which can influence its interaction with biological targets. Additionally, the compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. Its molecular structure suggests potential for further derivatization, which could enhance its pharmacological profile. Overall, 3-(Methylsulfonyl)-3,9-diazaspiro[5.5]undecane represents a fascinating area of study within organic and medicinal chemistry.
Formula:C10H20N2O2S
InChI:InChI=1S/C10H20N2O2S/c1-15(13,14)12-8-4-10(5-9-12)2-6-11-7-3-10/h11H,2-9H2,1H3
InChI key:InChIKey=YSKZBGKSCSZSJR-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)N1CCC2(CC1)CCNCC2
Synonyms:- 3-(Methylsulfonyl)-3,9-diazaspiro[5.5]undecane
- 3,9-Diazaspiro[5.5]undecane, 3-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.