CymitQuimica logo

CAS 1286754-17-3

:

1H-Pyrrole-1-pentanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide, hydrochloride (1:1)

Description:
1H-Pyrrole-1-pentanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide, hydrochloride (1:1) is a chemical compound characterized by its hydrazide functional group, which is derived from pyrrole, a five-membered aromatic heterocycle containing nitrogen. This compound features a pentanoic acid moiety, contributing to its potential biological activity. The presence of the dihydro-2,5-dioxo structure indicates that it may exhibit keto-enol tautomerism, which can influence its reactivity and stability. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, typical of many hydrazide derivatives. Its specific interactions and mechanisms of action would depend on its molecular structure and the presence of functional groups. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C9H13N3O3·ClH
InChI:InChI=1S/C9H13N3O3.ClH/c10-11-7(13)3-1-2-6-12-8(14)4-5-9(12)15;/h4-5H,1-3,6,10H2,(H,11,13);1H
InChI key:InChIKey=LONHVDZWNFFXCQ-UHFFFAOYSA-N
SMILES:C(CCCC(NN)=O)N1C(=O)C=CC1=O.Cl
Synonyms:
  • 1H-Pyrrole-1-pentanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.