CAS 1286754-49-1

3-Iodo-N-methylbenzenemethanesulfonamide

Description:

3-Iodo-N-methylbenzenemethanesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the iodo substituent at the meta position on the benzene ring influences its reactivity and potential applications in medicinal chemistry. The N-methyl group contributes to the compound's lipophilicity, which can enhance its ability to penetrate biological membranes. This compound may exhibit unique pharmacological properties due to the combination of the sulfonamide and iodo functionalities, making it of interest in drug development and research. Additionally, the sulfonamide moiety is often associated with various biological activities, including enzyme inhibition. The compound's molecular structure suggests potential interactions with biological targets, which could be explored in the context of therapeutic applications. As with many sulfonamides, it is essential to consider the compound's solubility, stability, and potential toxicity when evaluating its suitability for specific uses in pharmaceuticals or other fields.

Formula: C₈H₁₀INO₂S

InChI: InChI=1S/C8H10INO2S/c1-10-13(11,12)6-7-3-2-4-8(9)5-7/h2-5,10H,6H2,1H3

InChI key: InChIKey=BFTOYJWWVZDNEA-UHFFFAOYSA-N

SMILES: C(S(NC)(=O)=O)C1=CC(I)=CC=C1

Synonyms:

• Benzenemethanesulfonamide, 3-iodo-N-methyl-
• 3-Iodo-N-methylbenzenemethanesulfonamide