
CAS 1286754-60-6
:1,1-Dimethylethyl 3-(2,6-dimethoxyphenyl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 3-(2,6-dimethoxyphenyl)-1-piperazinecarboxylate, identified by its CAS number 1286754-60-6, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a 2,6-dimethoxyphenyl moiety, which contributes to its unique chemical properties and potential biological activity. The methoxy groups on the aromatic ring can influence the compound's solubility and reactivity, while the piperazine structure may impart pharmacological properties, making it of interest in medicinal chemistry. The ester functional group, indicated by the carboxylate, suggests potential for further chemical reactivity, such as hydrolysis or esterification. Overall, this compound's structural features suggest it may have applications in drug development or as a research chemical, although specific biological activities and applications would require further investigation.
Formula:C17H26N2O4
InChI:InChI=1S/C17H26N2O4/c1-17(2,3)23-16(20)19-10-9-18-12(11-19)15-13(21-4)7-6-8-14(15)22-5/h6-8,12,18H,9-11H2,1-5H3
InChI key:InChIKey=ZPCBRFZWBJJDKJ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(OC)=CC=C1)C2CN(C(OC(C)(C)C)=O)CCN2
Synonyms:- 1,1-Dimethylethyl 3-(2,6-dimethoxyphenyl)-1-piperazinecarboxylate
- 1-Piperazinecarboxylic acid, 3-(2,6-dimethoxyphenyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.