
CAS 1286754-85-5
:2-(5-Azaspiro[2.4]hept-7-ylmethylamino)ethanol
Description:
2-(5-Azaspiro[2.4]hept-7-ylmethylamino)ethanol is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in the spiro ring system. This compound features an amino group and an alcohol functional group, contributing to its potential as a bioactive molecule. The presence of the azaspiro framework suggests interesting conformational properties and may influence its interaction with biological targets. Typically, compounds with such structures are investigated for their pharmacological activities, including potential roles as neurotransmitter modulators or in other therapeutic applications. The molecular structure indicates that it may exhibit polar characteristics due to the hydroxyl group, which can enhance solubility in polar solvents. Additionally, the compound's specific stereochemistry and functional groups may play a crucial role in its reactivity and biological activity. Overall, 2-(5-Azaspiro[2.4]hept-7-ylmethylamino)ethanol represents a class of compounds that could be of interest in medicinal chemistry and drug development.
Formula:C9H18N2O
InChI:InChI=1S/C9H18N2O/c1-11(4-5-12)8-6-10-7-9(8)2-3-9/h8,10,12H,2-7H2,1H3
InChI key:InChIKey=WTLOQHPLNOPABA-UHFFFAOYSA-N
SMILES:N(CCO)(C)C1C2(CC2)CNC1
Synonyms:- 2-(5-Azaspiro[2.4]hept-7-ylmethylamino)ethanol
- Ethanol, 2-(5-azaspiro[2.4]hept-7-ylmethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.