
CAS 1286755-06-3
:2-[(4,4-Dimethyl-3-pyrrolidinyl)methylamino]ethanol
Description:
2-[(4,4-Dimethyl-3-pyrrolidinyl)methylamino]ethanol is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an ethanol moiety. This compound features a dimethyl substitution on the pyrrolidine nitrogen, contributing to its steric and electronic properties. It is typically classified as an amino alcohol, which indicates the presence of both an amino group and a hydroxyl group in its structure. The compound may exhibit solubility in polar solvents due to the hydroxyl group, while the pyrrolidine ring can influence its biological activity and interaction with various receptors. Its potential applications may span across pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. The presence of the dimethyl group may enhance lipophilicity, affecting the compound's pharmacokinetics. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would require further investigation.
Formula:C9H20N2O
InChI:InChI=1S/C9H20N2O/c1-9(2)7-10-6-8(9)11(3)4-5-12/h8,10,12H,4-7H2,1-3H3
InChI key:InChIKey=FERXJOHLCQVGNS-UHFFFAOYSA-N
SMILES:N(CCO)(C)C1C(C)(C)CNC1
Synonyms:- Ethanol, 2-[(4,4-dimethyl-3-pyrrolidinyl)methylamino]-
- 2-[(4,4-Dimethyl-3-pyrrolidinyl)methylamino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.