CAS 1286755-09-6

2-[[[[(Cyclopropylmethyl)amino]carbonyl]amino]oxy]acetic acid

Description:

2-[[[[(Cyclopropylmethyl)amino]carbonyl]amino]oxy]acetic acid, identified by its CAS number 1286755-09-6, is a chemical compound characterized by its complex structure that includes a cyclopropylmethyl group, an amino group, and an acetic acid moiety. This compound features multiple functional groups, including amine, carboxylic acid, and an ether-like linkage, which contribute to its potential reactivity and solubility properties. The presence of the cyclopropylmethyl group may impart unique steric and electronic characteristics, influencing its biological activity and interaction with other molecules. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, making them soluble in polar solvents. Additionally, the presence of the amino and carboxylic acid groups suggests potential for hydrogen bonding, which can affect the compound's stability and reactivity in various chemical environments. Overall, this compound may have applications in medicinal chemistry or as a biochemical probe, although specific biological activities would require further investigation.

Formula: C₇H₁₂N₂O₄

InChI: InChI=1S/C7H12N2O4/c10-6(11)4-13-9-7(12)8-3-5-1-2-5/h5H,1-4H2,(H,10,11)(H2,8,9,12)

InChI key: InChIKey=XXZHSLYABFAAEY-UHFFFAOYSA-N

SMILES: C(NC(NOCC(O)=O)=O)C1CC1

Synonyms:

• 2-[[[[(Cyclopropylmethyl)amino]carbonyl]amino]oxy]acetic acid
• Acetic acid, 2-[[[[(cyclopropylmethyl)amino]carbonyl]amino]oxy]-