CAS 1286755-21-2

Pyrazolo[5,1-b]oxazole-7-carboxylic acid, 2,3-dihydro-

Description:

Pyrazolo[5,1-b]oxazole-7-carboxylic acid, 2,3-dihydro- is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and oxazole rings. This compound typically features a carboxylic acid functional group, contributing to its acidic properties. The presence of the dihydro group indicates that the compound has two hydrogen atoms added to the oxazole ring, which can influence its reactivity and stability. Pyrazolo derivatives are often studied for their potential biological activities, including anti-inflammatory and antimicrobial properties. The compound's molecular structure allows for various interactions, making it a candidate for pharmaceutical applications. Additionally, its solubility and stability in different solvents can vary, affecting its utility in synthetic and medicinal chemistry. Overall, Pyrazolo[5,1-b]oxazole-7-carboxylic acid, 2,3-dihydro- represents a class of compounds with significant interest in research and development due to their diverse chemical properties and potential therapeutic applications.

Formula: C₆H₆N₂O₃

InChI: InChI=1S/C6H6N2O3/c9-6(10)4-3-7-8-1-2-11-5(4)8/h3H,1-2H2,(H,9,10)

InChI key: InChIKey=XPHNBRIOESOWQT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(N=C1)CCO2

Synonyms:

• 2,3-Dihydropyrazolo[5,1-b]oxazole-7-carboxylic acid
• 2H,3H-Pyrazolo[3,2-b][1,3]oxazole-7-carboxylic acid
• Pyrazolo[5,1-b]oxazole-7-carboxylic acid, 2,3-dihydro-

2,3-Dihydropyrazolo[5,1-b]oxazole-7-carboxylic acid

CAS: 1286755-21-2

Formula: C₆H₆N₂O₃

Molecular weight: 154.125

Ref: 10-F343468

2H,3H-Pyrazolo[3,2-b][1,3]oxazole-7-carboxylic acid

CAS: 1286755-21-2

Versatile small molecule scaffold

Formula: C₆H₆N₂O₃

Purity: Min. 95%

Molecular weight: 154.12 g/mol

Ref: 3D-LBC75521