CymitQuimica logo

CAS 1286755-27-8

:

5,6-Dihydro-8H-imidazo[2,1-c][1,4]oxazine-2-carbonitrile

Description:
5,6-Dihydro-8H-imidazo[2,1-c][1,4]oxazine-2-carbonitrile is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both imidazole and oxazine rings. This compound features a carbonitrile functional group, contributing to its potential reactivity and applications in organic synthesis. The presence of nitrogen and oxygen atoms in its structure suggests that it may exhibit interesting chemical properties, such as the ability to participate in hydrogen bonding and coordination with metal ions. Its molecular framework may also impart specific biological activities, making it a candidate for pharmaceutical research. The compound's CAS number, 1286755-27-8, allows for easy identification and retrieval of information in chemical databases. Overall, 5,6-Dihydro-8H-imidazo[2,1-c][1,4]oxazine-2-carbonitrile represents a class of compounds that could be explored for various applications, including medicinal chemistry and material science, due to its structural diversity and potential functional properties.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-3-6-4-10-1-2-11-5-7(10)9-6/h4H,1-2,5H2
InChI key:InChIKey=YDRWDYDRIYJNTQ-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C2N(C1)CCOC2
Synonyms:
  • 5,6-Dihydro-8H-imidazo[2,1-c][1,4]oxazine-2-carbonitrile
  • 8H-Imidazo[2,1-c][1,4]oxazine-2-carbonitrile, 5,6-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.