CAS 1286768-68-0

1,1-Dimethylethyl (2S)-2-methyl-4-morpholinecarboxylate

Description:

1,1-Dimethylethyl (2S)-2-methyl-4-morpholinecarboxylate, identified by its CAS number 1286768-68-0, is an organic compound characterized by its ester functional group, which is derived from morpholine and a carboxylic acid. This compound features a morpholine ring, contributing to its cyclic structure and potential biological activity. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which may influence its reactivity and solubility in various solvents. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the hydrophobic tert-butyl group, which can affect their interaction with biological membranes. Additionally, the stereochemistry indicated by the (2S) configuration suggests specific spatial arrangements that may be crucial for its biological activity or interaction with enzymes and receptors. Overall, this compound may have applications in pharmaceuticals or agrochemicals, but its specific properties, such as melting point, boiling point, and solubility, would require empirical data for precise characterization.

Formula: C₁₀H₁₉NO₃

InChI: InChI=1S/C10H19NO3/c1-8-7-11(5-6-13-8)9(12)14-10(2,3)4/h8H,5-7H2,1-4H3/t8-/m0/s1

InChI key: InChIKey=SNCYGCVDBMVSBB-QMMMGPOBSA-N

SMILES: C(OC(C)(C)C)(=O)N1C[C@H](C)OCC1

Synonyms:

• 1,1-Dimethylethyl (2S)-2-methyl-4-morpholinecarboxylate
• 4-Morpholinecarboxylic acid, 2-methyl-, 1,1-dimethylethyl ester, (2S)-