
CAS 1286768-84-0
:(αS)-α-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-fluoro-1-naphthalenepropanoic acid
Description:
The chemical substance known as (αS)-α-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-fluoro-1-naphthalenepropanoic acid, with the CAS number 1286768-84-0, is a synthetic organic compound characterized by its complex structure, which includes a naphthalene moiety and a fluorine atom. This compound features an amino acid derivative framework, indicating potential biological activity, particularly in pharmaceutical applications. The presence of the dimethylethoxycarbonyl group suggests it may be used as a protecting group in peptide synthesis or as a precursor in the development of more complex molecules. The fluorine substitution on the naphthalene ring can enhance lipophilicity and metabolic stability, making it a candidate for drug development. Additionally, the stereochemistry indicated by the (αS) designation implies specific spatial arrangements that can influence the compound's interaction with biological targets. Overall, this compound's unique structural features may contribute to its potential efficacy and specificity in therapeutic applications.
Formula:C18H20FNO4
InChI:InChI=1S/C18H20FNO4/c1-18(2,3)24-17(23)20-15(16(21)22)10-11-8-9-14(19)13-7-5-4-6-12(11)13/h4-9,15H,10H2,1-3H3,(H,20,23)(H,21,22)/t15-/m0/s1
InChI key:InChIKey=RDNXNWGZRPCJME-HNNXBMFYSA-N
SMILES:C([C@H](NC(OC(C)(C)C)=O)C(O)=O)C=1C2=C(C(F)=CC1)C=CC=C2
Synonyms:- 1-Naphthalenepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-4-fluoro-, (αS)-
- (αS)-α-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-fluoro-1-naphthalenepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.