CAS 1286777-07-8
:5-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid
Description:
5-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid, identified by its CAS number 1286777-07-8, is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2-position with a carboxylic acid group and at the 5-position with a cyclobutylmethoxy group. This compound exhibits properties typical of carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the cyclobutyl group may impart unique steric and electronic effects, potentially affecting the compound's biological activity and interaction with other molecules. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyridine moiety's prevalence in biologically active compounds. Additionally, the methoxy group can enhance lipophilicity, influencing the compound's pharmacokinetics. Overall, this compound's unique structural features make it a subject of interest for further research in various chemical and biological contexts.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c13-11(14)10-5-4-9(6-12-10)15-7-8-2-1-3-8/h4-6,8H,1-3,7H2,(H,13,14)
InChI key:InChIKey=WJNKVDVOQIODMC-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C=2C=CC(C(O)=O)=NC2
Synonyms:- 2-Pyridinecarboxylic acid, 5-(cyclobutylmethoxy)-
- 5-(Cyclobutylmethoxy)pyridine-2-carboxylic acid
- 5-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
