CAS 1286793-03-0

5-Acetyl-3,3-difluoro-1,3-dihydro-2H-indol-2-one

Description:

5-Acetyl-3,3-difluoro-1,3-dihydro-2H-indol-2-one is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features an acetyl group and two fluorine atoms attached to the carbon framework, contributing to its unique chemical properties. The presence of the acetyl group suggests that it may exhibit reactivity typical of carbonyl compounds, such as nucleophilic addition or condensation reactions. The difluoro substitution can enhance the compound's lipophilicity and influence its biological activity, potentially making it of interest in medicinal chemistry. Additionally, the indole moiety is known for its occurrence in various natural products and pharmaceuticals, often exhibiting diverse biological activities. The compound's molecular structure may also impart specific physical properties, such as solubility and melting point, which are important for its application in research and industry. Overall, 5-Acetyl-3,3-difluoro-1,3-dihydro-2H-indol-2-one represents a versatile scaffold for further chemical exploration and potential therapeutic development.

Formula: C₁₀H₇F₂NO₂

InChI: InChI=1S/C10H7F2NO2/c1-5(14)6-2-3-8-7(4-6)10(11,12)9(15)13-8/h2-4H,1H3,(H,13,15)

InChI key: InChIKey=JMHXINVNEPEARH-UHFFFAOYSA-N

SMILES: FC1(F)C=2C(NC1=O)=CC=C(C(C)=O)C2

Synonyms:

• 5-Acetyl-3,3-difluoro-1,3-dihydro-2H-indol-2-one
• 2H-Indol-2-one, 5-acetyl-3,3-difluoro-1,3-dihydro-