CAS 1287-16-7: Ferroceneacetic acid
Description:Ferroceneacetic acid, with the CAS number 1287-16-7, is an organometallic compound that features a ferrocene moiety, which consists of two cyclopentadienyl rings sandwiching a central iron atom. This compound exhibits unique characteristics due to the presence of both the ferrocene structure and the acetic acid functional group. Ferroceneacetic acid is typically characterized by its stability, solubility in organic solvents, and its ability to undergo various chemical reactions, including oxidation and substitution. The presence of the acetic acid group imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, ferrocene derivatives are known for their applications in materials science, catalysis, and as potential pharmaceuticals due to their electrochemical properties. The compound's redox behavior is of particular interest, as it can facilitate electron transfer processes, making it valuable in electrochemical applications. Overall, ferroceneacetic acid is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C12H12FeO2
InChI:InChI=1S/C7H7O2.C5H5.Fe/c8-7(9)5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-4H,5H2,(H,8,9);1-5H;/q2*-1;+2
InChI key:InChIKey=MOUVOWJUMAKBBM-UHFFFAOYSA-N
SMILES:O=C(O)C[C-]12[CH]3=[CH]4[CH]5=[CH]1[Fe+2]67894532[CH]=%10[CH]9=[CH]8[CH-]7[CH]%106
- Synonyms:
- (Carboxymethyl)ferrocene
- 1,2,3,4,5-Cyclopentanepentayl, 1-(Carboxymethyl)-, Compd. With 1,2,3,4,5-Cyclopentanepentayl, Iron Salt (1:1:1)
- Carboxymethylferrocene
- Cyclopentadieneacetic acid, cyclopentadienyliron deriv.
- Ferrocene, (carboxymethyl)-
- Ferroceneacetic acid
- Ferrocenfethanol
- Ferrocenyl Acetic Acid
- Iron, [(carboxymethyl)cyclopentadienyl]cyclopentadienyl-
- NSC 128978
- See more synonyms
