
CAS 128717-78-2
:7-Methoxy-1H-indole-3-carbonyl chloride
Description:
7-Methoxy-1H-indole-3-carbonyl chloride, with the CAS number 128717-78-2, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methoxy group at the 7-position and a carbonyl chloride functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals due to its ability to participate in nucleophilic substitution reactions. The carbonyl chloride group makes it a versatile reagent for acylation reactions, allowing for the introduction of various substituents. Additionally, the methoxy group can influence the compound's solubility and reactivity, making it an interesting subject for studies in medicinal chemistry. As with many chemical substances, handling should be done with care, considering its potential reactivity and the need for appropriate safety measures.
Formula:C10H8ClNO2
InChI:InChI=1S/C10H8ClNO2/c1-14-8-4-2-3-6-7(10(11)13)5-12-9(6)8/h2-5,12H,1H3
InChI key:InChIKey=QYFAKXJYDPVIGR-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C=2C(=C(OC)C=CC2)NC1
Synonyms:- 7-Methoxy-1H-indole-3-carbonyl chloride
- 1H-Indole-3-carbonyl chloride, 7-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
