
CAS 1287217-31-5
:3-Bromo-5,6,7,8,9,10-hexahydroimidazo[1,2-a]azocine
Description:
3-Bromo-5,6,7,8,9,10-hexahydroimidazo[1,2-a]azocine is a bicyclic compound characterized by its unique imidazoazocine structure, which incorporates a bromine substituent at the 3-position. This compound features a fused ring system that contributes to its potential biological activity and chemical reactivity. The presence of the bromine atom can enhance its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The hexahydro configuration indicates that the compound is saturated, which may influence its stability and solubility in different solvents. Additionally, the imidazo ring system is known for its presence in various pharmacologically active compounds, suggesting that this substance may exhibit interesting biological properties. Its specific applications and interactions would depend on further studies, including its synthesis, reactivity, and potential uses in medicinal chemistry or materials science. Overall, 3-Bromo-5,6,7,8,9,10-hexahydroimidazo[1,2-a]azocine represents a complex structure with potential significance in chemical research.
Formula:C9H13BrN2
InChI:InChI=1S/C9H13BrN2/c10-8-7-11-9-5-3-1-2-4-6-12(8)9/h7H,1-6H2
InChI key:InChIKey=CAZAWBMVQUOTOG-UHFFFAOYSA-N
SMILES:BrC=1N2C(=NC1)CCCCCC2
Synonyms:- 3-Bromo-5,6,7,8,9,10-hexahydroimidazo[1,2-a]azocine
- Imidazo[1,2-a]azocine, 3-bromo-5,6,7,8,9,10-hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.