CAS 1287217-35-9

6-[(Tetrahydro-2H-pyran-2-yl)methoxy]-2-pyridinecarboxylic acid

Description:

6-[(Tetrahydro-2H-pyran-2-yl)methoxy]-2-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a tetrahydropyran moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The tetrahydropyran ring adds to the compound's complexity, potentially affecting its conformational flexibility and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Overall, the structural features of 6-[(Tetrahydro-2H-pyran-2-yl)methoxy]-2-pyridinecarboxylic acid suggest potential applications in drug development and other chemical research areas.

Formula: C₁₂H₁₅NO₄

InChI: InChI=1S/C12H15NO4/c14-12(15)10-5-3-6-11(13-10)17-8-9-4-1-2-7-16-9/h3,5-6,9H,1-2,4,7-8H2,(H,14,15)

InChI key: InChIKey=UIZMPUQMXOCNIR-UHFFFAOYSA-N

SMILES: O(CC1CCCCO1)C=2N=C(C(O)=O)C=CC2

Synonyms:

• 2-Pyridinecarboxylic acid, 6-[(tetrahydro-2H-pyran-2-yl)methoxy]-
• 6-[(Tetrahydro-2H-pyran-2-yl)methoxy]-2-pyridinecarboxylic acid