
CAS 1287217-61-1
:6-(Cyclopropylmethoxy)-2-pyridinecarbonitrile
Description:
6-(Cyclopropylmethoxy)-2-pyridinecarbonitrile is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted at the 6-position with a cyclopropylmethoxy group and a cyano group at the 2-position. The presence of the pyridine moiety contributes to its aromatic properties, while the cyano group introduces a polar functional group that can influence its reactivity and solubility. The cyclopropylmethoxy substituent adds steric hindrance and may affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and cyclopropyl components, which can impact its pharmacokinetic properties. Additionally, the nitrile functional group may participate in hydrogen bonding and other interactions, potentially influencing its biological activity. Overall, 6-(Cyclopropylmethoxy)-2-pyridinecarbonitrile represents a complex structure that may have applications in drug discovery and development, particularly in the context of targeting specific biological pathways.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c11-6-9-2-1-3-10(12-9)13-7-8-4-5-8/h1-3,8H,4-5,7H2
InChI key:InChIKey=OQSAPHYIPMOYKU-UHFFFAOYSA-N
SMILES:O(CC1CC1)C=2N=C(C#N)C=CC2
Synonyms:- 2-Pyridinecarbonitrile, 6-(cyclopropylmethoxy)-
- 6-(Cyclopropylmethoxy)-2-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.