CAS 1287218-05-6

4-(4-Methylphenyl)-2-pyridinecarboxaldehyde

Description:

4-(4-Methylphenyl)-2-pyridinecarboxaldehyde, with the CAS number 1287218-05-6, is an organic compound characterized by its structure, which features a pyridine ring substituted with a carboxaldehyde group and a para-methylphenyl group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the presence of both the pyridine and phenyl rings. It exhibits reactivity typical of aldehydes, such as undergoing oxidation and participating in condensation reactions. The presence of the methyl group on the phenyl ring can influence its electronic properties, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in the development of pharmaceuticals or as a building block in complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₃H₁₁NO

InChI: InChI=1S/C13H11NO/c1-10-2-4-11(5-3-10)12-6-7-14-13(8-12)9-15/h2-9H,1H3

InChI key: InChIKey=TYTALFZGYDQCGZ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=CC=N1)C2=CC=C(C)C=C2

Synonyms:

• 4-(4-Methylphenyl)-2-pyridinecarboxaldehyde
• 2-Pyridinecarboxaldehyde, 4-(4-methylphenyl)-