CymitQuimica logo

CAS 1287218-23-8

:

7-Chloro-1-methyl-5-nitro-1H-benzimidazole

Description:
7-Chloro-1-methyl-5-nitro-1H-benzimidazole is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a chlorine atom at the 7-position, a methyl group at the 1-position, and a nitro group at the 5-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring structure. The presence of the nitro group may impart additional reactivity and influence its solubility and stability in various solvents. As a benzimidazole derivative, it may be of interest in pharmaceutical research, particularly for its potential antimicrobial or anticancer properties. The compound's molecular interactions, such as hydrogen bonding and π-π stacking, can also play a significant role in its biological activity and efficacy. Safety and handling considerations should be taken into account, as with many halogenated and nitro-substituted compounds, due to potential toxicity and environmental impact.
Formula:C8H6ClN3O2
InChI:InChI=1S/C8H6ClN3O2/c1-11-4-10-7-3-5(12(13)14)2-6(9)8(7)11/h2-4H,1H3
InChI key:InChIKey=HGZVRISBIBYVNB-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(N(=O)=O)=C1)N=CN2C
Synonyms:
  • 7-Chloro-1-methyl-5-nitro-1H-benzimidazole
  • 1H-Benzimidazole, 7-chloro-1-methyl-5-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.