
CAS 1287218-58-9
:3-[[6-(Trifluoromethyl)-2-pyridinyl]oxy]benzoic acid
Description:
3-[[6-(Trifluoromethyl)-2-pyridinyl]oxy]benzoic acid, identified by its CAS number 1287218-58-9, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety and a pyridine ring substituted with a trifluoromethyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the carboxylic acid functional group and the electron-withdrawing trifluoromethyl group. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the pyridine ring can contribute to its ability to form coordination complexes with metal ions. The compound's unique structural features may also impart specific characteristics such as stability under certain conditions and potential applications in agrochemicals or medicinal chemistry. Overall, its chemical behavior and interactions are influenced by the interplay of its functional groups and molecular structure.
Formula:C13H8F3NO3
InChI:InChI=1S/C13H8F3NO3/c14-13(15,16)10-5-2-6-11(17-10)20-9-4-1-3-8(7-9)12(18)19/h1-7H,(H,18,19)
InChI key:InChIKey=UWYPBJPQEGBZET-UHFFFAOYSA-N
SMILES:O(C=1N=C(C(F)(F)F)C=CC1)C2=CC(C(O)=O)=CC=C2
Synonyms:- Benzoic acid, 3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-
- 3-[[6-(Trifluoromethyl)-2-pyridinyl]oxy]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.